C10H11F2NS — CID 130654551
N-[(2,4-difluorophenyl)methyl]thietan-3-amine (PubChem CID 130654551) has the molecular formula C10H11F2NS and a molecular weight of 215.27 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]thietan-3-amine.
| Compound Name | N-[(2,4-difluorophenyl)methyl]thietan-3-amine |
|---|---|
| PubChem CID | 130654551 |
| Molecular Formula | C10H11F2NS |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]thietan-3-amine |
| SMILES | Fc1ccc(CNC2CSC2)c(F)c1 |
| InChI | InChI=1S/C10H11F2NS/c11-8-2-1-7(10(12)3-8)4-13-9-5-14-6-9/h1-3,9,13H,4-6H2 |
| InChIKey | UGWMKFJERJNLQC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |