C12H15F2NOS — CID 55048533
N-[(2,4-difluorophenyl)methyl]-1-oxothian-4-amine (PubChem CID 55048533) has the molecular formula C12H15F2NOS and a molecular weight of 259.32 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-1-oxothian-4-amine.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-1-oxothian-4-amine |
|---|---|
| PubChem CID | 55048533 |
| Molecular Formula | C12H15F2NOS |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-1-oxothian-4-amine |
| SMILES | O=S1CCC(NCc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C12H15F2NOS/c13-10-2-1-9(12(14)7-10)8-15-11-3-5-17(16)6-4-11/h1-2,7,11,15H,3-6,8H2 |
| InChIKey | OMMFAHBXSFEJDL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |