C13H18F2N2 — CID 62313669
4-N-[(2,4-difluorophenyl)methyl]cyclohexane-1,4-diamine (PubChem CID 62313669) has the molecular formula C13H18F2N2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4-N-[(2,4-difluorophenyl)methyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[(2,4-difluorophenyl)methyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 62313669 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 4-N-[(2,4-difluorophenyl)methyl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(NCc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C13H18F2N2/c14-10-2-1-9(13(15)7-10)8-17-12-5-3-11(16)4-6-12/h1-2,7,11-12,17H,3-6,8,16H2 |
| InChIKey | PHLJYBOLNUNGRF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |