C12H15ClFNOS — CID 113479791
N-[(4-chloro-3-fluorophenyl)methyl]-1-oxothian-4-amine (PubChem CID 113479791) has the molecular formula C12H15ClFNOS and a molecular weight of 275.78 g/mol. Its IUPAC name is N-[(4-chloro-3-fluorophenyl)methyl]-1-oxothian-4-amine.
| Compound Name | N-[(4-chloro-3-fluorophenyl)methyl]-1-oxothian-4-amine |
|---|---|
| PubChem CID | 113479791 |
| Molecular Formula | C12H15ClFNOS |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | N-[(4-chloro-3-fluorophenyl)methyl]-1-oxothian-4-amine |
| SMILES | O=S1CCC(NCc2ccc(Cl)c(F)c2)CC1 |
| InChI | InChI=1S/C12H15ClFNOS/c13-11-2-1-9(7-12(11)14)8-15-10-3-5-17(16)6-4-10/h1-2,7,10,15H,3-6,8H2 |
| InChIKey | FLCNLMIAKMLTRJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |