C10H15NOS2 — CID 63248071
1-oxo-N-(thiophen-3-ylmethyl)thian-4-amine (PubChem CID 63248071) has the molecular formula C10H15NOS2 and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-oxo-N-(thiophen-3-ylmethyl)thian-4-amine.
| Compound Name | 1-oxo-N-(thiophen-3-ylmethyl)thian-4-amine |
|---|---|
| PubChem CID | 63248071 |
| Molecular Formula | C10H15NOS2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 1-oxo-N-(thiophen-3-ylmethyl)thian-4-amine |
| SMILES | O=S1CCC(NCc2ccsc2)CC1 |
| InChI | InChI=1S/C10H15NOS2/c12-14-5-2-10(3-6-14)11-7-9-1-4-13-8-9/h1,4,8,10-11H,2-3,5-7H2 |
| InChIKey | VLTNTIJFRZSPGQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |