C10H16N2S — CID 63248070
N-(thiophen-3-ylmethyl)piperidin-3-amine (PubChem CID 63248070) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is N-(thiophen-3-ylmethyl)piperidin-3-amine.
| Compound Name | N-(thiophen-3-ylmethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 63248070 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | N-(thiophen-3-ylmethyl)piperidin-3-amine |
| SMILES | c1cc(CNC2CCCNC2)cs1 |
| InChI | InChI=1S/C10H16N2S/c1-2-10(7-11-4-1)12-6-9-3-5-13-8-9/h3,5,8,10-12H,1-2,4,6-7H2 |
| InChIKey | SKYIENPZJRIYTH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |