C11H11ClF2S — CID 83191354
3-chloro-4-[(2,4-difluorophenyl)methyl]thiolane (PubChem CID 83191354) has the molecular formula C11H11ClF2S and a molecular weight of 248.72 g/mol. Its IUPAC name is 3-chloro-4-[(2,4-difluorophenyl)methyl]thiolane.
| Compound Name | 3-chloro-4-[(2,4-difluorophenyl)methyl]thiolane |
|---|---|
| PubChem CID | 83191354 |
| Molecular Formula | C11H11ClF2S |
| Molecular Weight | 248.72 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 3-chloro-4-[(2,4-difluorophenyl)methyl]thiolane |
| SMILES | Fc1ccc(CC2CSCC2Cl)c(F)c1 |
| InChI | InChI=1S/C11H11ClF2S/c12-10-6-15-5-8(10)3-7-1-2-9(13)4-11(7)14/h1-2,4,8,10H,3,5-6H2 |
| InChIKey | ZJKGVYHJOGOZTH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.72 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|