C13H15ClF2 — CID 64908376
1-[(3-chloro-2-methylcyclopentyl)methyl]-2,4-difluorobenzene (PubChem CID 64908376) has the molecular formula C13H15ClF2 and a molecular weight of 244.71 g/mol. Its IUPAC name is 1-[(3-chloro-2-methylcyclopentyl)methyl]-2,4-difluorobenzene.
| Compound Name | 1-[(3-chloro-2-methylcyclopentyl)methyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 64908376 |
| Molecular Formula | C13H15ClF2 |
| Molecular Weight | 244.71 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-[(3-chloro-2-methylcyclopentyl)methyl]-2,4-difluorobenzene |
| SMILES | CC1C(Cl)CCC1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C13H15ClF2/c1-8-9(3-5-12(8)14)6-10-2-4-11(15)7-13(10)16/h2,4,7-9,12H,3,5-6H2,1H3 |
| InChIKey | ZGPLJCMTRRLWKT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|