C11H12ClFOS — CID 114857897
4-[(4-chloro-2-fluorophenyl)methyl]thiolan-3-ol (PubChem CID 114857897) has the molecular formula C11H12ClFOS and a molecular weight of 246.73 g/mol. Its IUPAC name is 4-[(4-chloro-2-fluorophenyl)methyl]thiolan-3-ol.
| Compound Name | 4-[(4-chloro-2-fluorophenyl)methyl]thiolan-3-ol |
|---|---|
| PubChem CID | 114857897 |
| Molecular Formula | C11H12ClFOS |
| Molecular Weight | 246.73 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 4-[(4-chloro-2-fluorophenyl)methyl]thiolan-3-ol |
| SMILES | OC1CSCC1Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H12ClFOS/c12-9-2-1-7(10(13)4-9)3-8-5-15-6-11(8)14/h1-2,4,8,11,14H,3,5-6H2 |
| InChIKey | IYEIFWIWVOPYQG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |