C13H17ClFNS — CID 114850813
4-[(4-chloro-2-fluorophenyl)methyl]-N-ethylthiolan-3-amine (PubChem CID 114850813) has the molecular formula C13H17ClFNS and a molecular weight of 273.80 g/mol. Its IUPAC name is 4-[(4-chloro-2-fluorophenyl)methyl]-N-ethylthiolan-3-amine.
| Compound Name | 4-[(4-chloro-2-fluorophenyl)methyl]-N-ethylthiolan-3-amine |
|---|---|
| PubChem CID | 114850813 |
| Molecular Formula | C13H17ClFNS |
| Molecular Weight | 273.80 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 4-[(4-chloro-2-fluorophenyl)methyl]-N-ethylthiolan-3-amine |
| SMILES | CCNC1CSCC1Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H17ClFNS/c1-2-16-13-8-17-7-10(13)5-9-3-4-11(14)6-12(9)15/h3-4,6,10,13,16H,2,5,7-8H2,1H3 |
| InChIKey | DMYPJUGWKGMVQA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |