C17H23Cl2F — CID 114857917
1-[(5-tert-butyl-2-chlorocyclohexyl)methyl]-4-chloro-2-fluorobenzene (PubChem CID 114857917) has the molecular formula C17H23Cl2F and a molecular weight of 317.28 g/mol. Its IUPAC name is 1-[(5-tert-butyl-2-chlorocyclohexyl)methyl]-4-chloro-2-fluorobenzene.
| Compound Name | 1-[(5-tert-butyl-2-chlorocyclohexyl)methyl]-4-chloro-2-fluorobenzene |
|---|---|
| PubChem CID | 114857917 |
| Molecular Formula | C17H23Cl2F |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-[(5-tert-butyl-2-chlorocyclohexyl)methyl]-4-chloro-2-fluorobenzene |
| SMILES | CC(C)(C)C1CCC(Cl)C(Cc2ccc(Cl)cc2F)C1 |
| InChI | InChI=1S/C17H23Cl2F/c1-17(2,3)13-5-7-15(19)12(9-13)8-11-4-6-14(18)10-16(11)20/h4,6,10,12-13,15H,5,7-9H2,1-3H3 |
| InChIKey | JSVDHLCAYAVELU-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|