C17H24BrCl — CID 63459699
1-bromo-3-[(5-tert-butyl-2-chlorocyclohexyl)methyl]benzene (PubChem CID 63459699) has the molecular formula C17H24BrCl and a molecular weight of 343.74 g/mol. Its IUPAC name is 1-bromo-3-[(5-tert-butyl-2-chlorocyclohexyl)methyl]benzene.
| Compound Name | 1-bromo-3-[(5-tert-butyl-2-chlorocyclohexyl)methyl]benzene |
|---|---|
| PubChem CID | 63459699 |
| Molecular Formula | C17H24BrCl |
| Molecular Weight | 343.74 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-bromo-3-[(5-tert-butyl-2-chlorocyclohexyl)methyl]benzene |
| SMILES | CC(C)(C)C1CCC(Cl)C(Cc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C17H24BrCl/c1-17(2,3)14-7-8-16(19)13(11-14)9-12-5-4-6-15(18)10-12/h4-6,10,13-14,16H,7-9,11H2,1-3H3 |
| InChIKey | GDORTIDSJHWUBR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.74 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|