C18H28FN — CID 63401443
4-tert-butyl-2-[(3-fluorophenyl)methyl]-N-methylcyclohexan-1-amine (PubChem CID 63401443) has the molecular formula C18H28FN and a molecular weight of 277.43 g/mol. Its IUPAC name is 4-tert-butyl-2-[(3-fluorophenyl)methyl]-N-methylcyclohexan-1-amine.
| Compound Name | 4-tert-butyl-2-[(3-fluorophenyl)methyl]-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 63401443 |
| Molecular Formula | C18H28FN |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 4-tert-butyl-2-[(3-fluorophenyl)methyl]-N-methylcyclohexan-1-amine |
| SMILES | CNC1CCC(C(C)(C)C)CC1Cc1cccc(F)c1 |
| InChI | InChI=1S/C18H28FN/c1-18(2,3)15-8-9-17(20-4)14(12-15)10-13-6-5-7-16(19)11-13/h5-7,11,14-15,17,20H,8-10,12H2,1-4H3 |
| InChIKey | KCUPUGQQXIGBMK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |