About 4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine
4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine (PubChem CID 63401757) has the molecular formula C20H33N
and a molecular weight of 287.49 g/mol. Its IUPAC name is 4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine |
| PubChem CID | 63401757 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine |
| SMILES | CNC1CCC(C(C)(C)C)CC1Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H33N/c1-14-7-8-16(11-15(14)2)12-17-13-18(20(3,4)5)9-10-19(17)21-6/h7-8,11,17-19,21H,9-10,12-13H2,1-6H3 |
| InChIKey | HJLHAYYEJPAELQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine?
The IUPAC name of 4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine (CID 63401757) is 4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine.
What is the SMILES notation for 4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine?
The canonical SMILES for 4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine is CNC1CCC(C(C)(C)C)CC1Cc1ccc(C)c(C)c1.
What is the InChIKey of 4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine?
The InChIKey is HJLHAYYEJPAELQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33N/c1-14-7-8-16(11-15(14)2)12-17-13-18(20(3,4)5)9-10-19(17)21-6/h7-8,11,17-19,21H,9-10,12-13H2,1-6H3.
What are the key properties of 4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine?
4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine has a molecular weight of 287.49 g/mol, XLogP of 4.90, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-[(3,4-dimethylphenyl)methyl]-N-methylcyclohexan-1-amine is sourced from PubChem (CID 63401757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).