C17H23BrF2 — CID 63470899
2-[(2-bromo-5-tert-butylcyclohexyl)methyl]-1,4-difluorobenzene (PubChem CID 63470899) has the molecular formula C17H23BrF2 and a molecular weight of 345.27 g/mol. Its IUPAC name is 2-[(2-bromo-5-tert-butylcyclohexyl)methyl]-1,4-difluorobenzene.
| Compound Name | 2-[(2-bromo-5-tert-butylcyclohexyl)methyl]-1,4-difluorobenzene |
|---|---|
| PubChem CID | 63470899 |
| Molecular Formula | C17H23BrF2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-[(2-bromo-5-tert-butylcyclohexyl)methyl]-1,4-difluorobenzene |
| SMILES | CC(C)(C)C1CCC(Br)C(Cc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C17H23BrF2/c1-17(2,3)13-4-6-15(18)11(9-13)8-12-10-14(19)5-7-16(12)20/h5,7,10-11,13,15H,4,6,8-9H2,1-3H3 |
| InChIKey | OKOGBMZNDNPHPO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|