C14H17BrClF — CID 102619694
2-[(2-bromo-5-methylcyclohexyl)methyl]-1-chloro-4-fluorobenzene (PubChem CID 102619694) has the molecular formula C14H17BrClF and a molecular weight of 319.65 g/mol. Its IUPAC name is 2-[(2-bromo-5-methylcyclohexyl)methyl]-1-chloro-4-fluorobenzene.
| Compound Name | 2-[(2-bromo-5-methylcyclohexyl)methyl]-1-chloro-4-fluorobenzene |
|---|---|
| PubChem CID | 102619694 |
| Molecular Formula | C14H17BrClF |
| Molecular Weight | 319.65 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 2-[(2-bromo-5-methylcyclohexyl)methyl]-1-chloro-4-fluorobenzene |
| SMILES | CC1CCC(Br)C(Cc2cc(F)ccc2Cl)C1 |
| InChI | InChI=1S/C14H17BrClF/c1-9-2-4-13(15)10(6-9)7-11-8-12(17)3-5-14(11)16/h3,5,8-10,13H,2,4,6-7H2,1H3 |
| InChIKey | PPSJGPBOXBCFEI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.65 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|