C16H21Br2F — CID 63471295
1-bromo-2-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-4-fluorobenzene (PubChem CID 63471295) has the molecular formula C16H21Br2F and a molecular weight of 392.15 g/mol. Its IUPAC name is 1-bromo-2-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-4-fluorobenzene.
| Compound Name | 1-bromo-2-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 63471295 |
| Molecular Formula | C16H21Br2F |
| Molecular Weight | 392.15 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | 1-bromo-2-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-4-fluorobenzene |
| SMILES | CC(C)C1CCC(Br)C(Cc2cc(F)ccc2Br)C1 |
| InChI | InChI=1S/C16H21Br2F/c1-10(2)11-3-5-15(17)12(7-11)8-13-9-14(19)4-6-16(13)18/h4,6,9-12,15H,3,5,7-8H2,1-2H3 |
| InChIKey | BGAXHIAPVNRNJU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.15 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|