C18H27Br — CID 55191885
1-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-3,5-dimethylbenzene (PubChem CID 55191885) has the molecular formula C18H27Br and a molecular weight of 323.32 g/mol. Its IUPAC name is 1-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-3,5-dimethylbenzene.
| Compound Name | 1-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 55191885 |
| Molecular Formula | C18H27Br |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 1-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(CC2CC(C(C)C)CCC2Br)c1 |
| InChI | InChI=1S/C18H27Br/c1-12(2)16-5-6-18(19)17(11-16)10-15-8-13(3)7-14(4)9-15/h7-9,12,16-18H,5-6,10-11H2,1-4H3 |
| InChIKey | PRTORTIKARDSHU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|