C16H21Br2NO2 — CID 63472821
2-bromo-1-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-4-nitrobenzene (PubChem CID 63472821) has the molecular formula C16H21Br2NO2 and a molecular weight of 419.16 g/mol. Its IUPAC name is 2-bromo-1-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-4-nitrobenzene.
| Compound Name | 2-bromo-1-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-4-nitrobenzene |
|---|---|
| PubChem CID | 63472821 |
| Molecular Formula | C16H21Br2NO2 |
| Molecular Weight | 419.16 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | 2-bromo-1-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-4-nitrobenzene |
| SMILES | CC(C)C1CCC(Br)C(Cc2ccc([N+](=O)[O-])cc2Br)C1 |
| InChI | InChI=1S/C16H21Br2NO2/c1-10(2)11-4-6-15(17)13(7-11)8-12-3-5-14(19(20)21)9-16(12)18/h3,5,9-11,13,15H,4,6-8H2,1-2H3 |
| InChIKey | VMCYYQDRSMEKDH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.16 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|