C16H21BrClNO2 — CID 79556177
2-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-4-chloro-1-nitrobenzene (PubChem CID 79556177) has the molecular formula C16H21BrClNO2 and a molecular weight of 374.71 g/mol. Its IUPAC name is 2-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-4-chloro-1-nitrobenzene.
| Compound Name | 2-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-4-chloro-1-nitrobenzene |
|---|---|
| PubChem CID | 79556177 |
| Molecular Formula | C16H21BrClNO2 |
| Molecular Weight | 374.71 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-[(2-bromo-5-propan-2-ylcyclohexyl)methyl]-4-chloro-1-nitrobenzene |
| SMILES | CC(C)C1CCC(Br)C(Cc2cc(Cl)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H21BrClNO2/c1-10(2)11-3-5-15(17)12(7-11)8-13-9-14(18)4-6-16(13)19(20)21/h4,6,9-12,15H,3,5,7-8H2,1-2H3 |
| InChIKey | OHFWKODXWCRMRM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.71 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|