C19H29Cl — CID 63471293
2-[(2-chloro-5-propan-2-ylcyclohexyl)methyl]-1,3,5-trimethylbenzene (PubChem CID 63471293) has the molecular formula C19H29Cl and a molecular weight of 292.89 g/mol. Its IUPAC name is 2-[(2-chloro-5-propan-2-ylcyclohexyl)methyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[(2-chloro-5-propan-2-ylcyclohexyl)methyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 63471293 |
| Molecular Formula | C19H29Cl |
| Molecular Weight | 292.89 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-[(2-chloro-5-propan-2-ylcyclohexyl)methyl]-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(CC2CC(C(C)C)CCC2Cl)c(C)c1 |
| InChI | InChI=1S/C19H29Cl/c1-12(2)16-6-7-19(20)17(10-16)11-18-14(4)8-13(3)9-15(18)5/h8-9,12,16-17,19H,6-7,10-11H2,1-5H3 |
| InChIKey | YGIGWNWGIXZOSL-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.89 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|