C18H28ClNO — CID 63471290
2-[(2-chloro-5-propan-2-ylcyclohexyl)methyl]-4-methoxy-3,5-dimethylpyridine (PubChem CID 63471290) has the molecular formula C18H28ClNO and a molecular weight of 309.88 g/mol. Its IUPAC name is 2-[(2-chloro-5-propan-2-ylcyclohexyl)methyl]-4-methoxy-3,5-dimethylpyridine.
| Compound Name | 2-[(2-chloro-5-propan-2-ylcyclohexyl)methyl]-4-methoxy-3,5-dimethylpyridine |
|---|---|
| PubChem CID | 63471290 |
| Molecular Formula | C18H28ClNO |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-[(2-chloro-5-propan-2-ylcyclohexyl)methyl]-4-methoxy-3,5-dimethylpyridine |
| SMILES | COc1c(C)cnc(CC2CC(C(C)C)CCC2Cl)c1C |
| InChI | InChI=1S/C18H28ClNO/c1-11(2)14-6-7-16(19)15(8-14)9-17-13(4)18(21-5)12(3)10-20-17/h10-11,14-16H,6-9H2,1-5H3 |
| InChIKey | WXWICZAGQIFFQB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|