C11H13ClFNS — CID 102616769
4-[(2-chloro-5-fluorophenyl)methyl]thiolan-3-amine (PubChem CID 102616769) has the molecular formula C11H13ClFNS and a molecular weight of 245.75 g/mol. Its IUPAC name is 4-[(2-chloro-5-fluorophenyl)methyl]thiolan-3-amine.
| Compound Name | 4-[(2-chloro-5-fluorophenyl)methyl]thiolan-3-amine |
|---|---|
| PubChem CID | 102616769 |
| Molecular Formula | C11H13ClFNS |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 4-[(2-chloro-5-fluorophenyl)methyl]thiolan-3-amine |
| SMILES | NC1CSCC1Cc1cc(F)ccc1Cl |
| InChI | InChI=1S/C11H13ClFNS/c12-10-2-1-9(13)4-7(10)3-8-5-15-6-11(8)14/h1-2,4,8,11H,3,5-6,14H2 |
| InChIKey | WYAOXSDXCJMPJE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |