C11H13F2NS — CID 83196495
4-[(2,3-difluorophenyl)methyl]thiolan-3-amine (PubChem CID 83196495) has the molecular formula C11H13F2NS and a molecular weight of 229.29 g/mol. Its IUPAC name is 4-[(2,3-difluorophenyl)methyl]thiolan-3-amine.
| Compound Name | 4-[(2,3-difluorophenyl)methyl]thiolan-3-amine |
|---|---|
| PubChem CID | 83196495 |
| Molecular Formula | C11H13F2NS |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4-[(2,3-difluorophenyl)methyl]thiolan-3-amine |
| SMILES | NC1CSCC1Cc1cccc(F)c1F |
| InChI | InChI=1S/C11H13F2NS/c12-9-3-1-2-7(11(9)13)4-8-5-15-6-10(8)14/h1-3,8,10H,4-6,14H2 |
| InChIKey | YQGCDLYCCUKVGQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |