About 4-[(2,3-difluorophenyl)methyl]thiolan-3-one
4-[(2,3-difluorophenyl)methyl]thiolan-3-one (PubChem CID 83196682) has the molecular formula C11H10F2OS
and a molecular weight of 228.26 g/mol. Its IUPAC name is 4-[(2,3-difluorophenyl)methyl]thiolan-3-one.
Molecular Properties
| Compound Name | 4-[(2,3-difluorophenyl)methyl]thiolan-3-one |
| PubChem CID | 83196682 |
| Molecular Formula | C11H10F2OS |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 4-[(2,3-difluorophenyl)methyl]thiolan-3-one |
| SMILES | O=C1CSCC1Cc1cccc(F)c1F |
| InChI | InChI=1S/C11H10F2OS/c12-9-3-1-2-7(11(9)13)4-8-5-15-6-10(8)14/h1-3,8H,4-6H2 |
| InChIKey | MKPIEYIDIFJVRW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(2,3-difluorophenyl)methyl]thiolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,3-difluorophenyl)methyl]thiolan-3-one?
The IUPAC name of 4-[(2,3-difluorophenyl)methyl]thiolan-3-one (CID 83196682) is 4-[(2,3-difluorophenyl)methyl]thiolan-3-one.
What is the SMILES notation for 4-[(2,3-difluorophenyl)methyl]thiolan-3-one?
The canonical SMILES for 4-[(2,3-difluorophenyl)methyl]thiolan-3-one is O=C1CSCC1Cc1cccc(F)c1F.
What is the InChIKey of 4-[(2,3-difluorophenyl)methyl]thiolan-3-one?
The InChIKey is MKPIEYIDIFJVRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2OS/c12-9-3-1-2-7(11(9)13)4-8-5-15-6-10(8)14/h1-3,8H,4-6H2.
What are the key properties of 4-[(2,3-difluorophenyl)methyl]thiolan-3-one?
4-[(2,3-difluorophenyl)methyl]thiolan-3-one has a molecular weight of 228.26 g/mol, XLogP of 2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,3-difluorophenyl)methyl]thiolan-3-one is sourced from PubChem (CID 83196682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).