C11H10F2OS — CID 83196682
4-[(2,3-difluorophenyl)methyl]thiolan-3-one (PubChem CID 83196682) has the molecular formula C11H10F2OS and a molecular weight of 228.26 g/mol. Its IUPAC name is 4-[(2,3-difluorophenyl)methyl]thiolan-3-one.
| Compound Name | 4-[(2,3-difluorophenyl)methyl]thiolan-3-one |
|---|---|
| PubChem CID | 83196682 |
| Molecular Formula | C11H10F2OS |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 4-[(2,3-difluorophenyl)methyl]thiolan-3-one |
| SMILES | O=C1CSCC1Cc1cccc(F)c1F |
| InChI | InChI=1S/C11H10F2OS/c12-9-3-1-2-7(11(9)13)4-8-5-15-6-10(8)14/h1-3,8H,4-6H2 |
| InChIKey | MKPIEYIDIFJVRW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |