C14H16F2O2 — CID 81009415
2-[(2,3-difluorophenyl)methyl]cyclohexane-1-carboxylic acid (PubChem CID 81009415) has the molecular formula C14H16F2O2 and a molecular weight of 254.28 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[(2,3-difluorophenyl)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81009415 |
| Molecular Formula | C14H16F2O2 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1Cc1cccc(F)c1F |
| InChI | InChI=1S/C14H16F2O2/c15-12-7-3-5-10(13(12)16)8-9-4-1-2-6-11(9)14(17)18/h3,5,7,9,11H,1-2,4,6,8H2,(H,17,18) |
| InChIKey | WMVJBUTVWBVVSF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |