C17H25F2N — CID 81028870
N-[[2-[(2,3-difluorophenyl)methyl]cyclohexyl]methyl]propan-1-amine (PubChem CID 81028870) has the molecular formula C17H25F2N and a molecular weight of 281.39 g/mol. Its IUPAC name is N-[[2-[(2,3-difluorophenyl)methyl]cyclohexyl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(2,3-difluorophenyl)methyl]cyclohexyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81028870 |
| Molecular Formula | C17H25F2N |
| Molecular Weight | 281.39 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | N-[[2-[(2,3-difluorophenyl)methyl]cyclohexyl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCCCC1Cc1cccc(F)c1F |
| InChI | InChI=1S/C17H25F2N/c1-2-10-20-12-15-7-4-3-6-13(15)11-14-8-5-9-16(18)17(14)19/h5,8-9,13,15,20H,2-4,6-7,10-12H2,1H3 |
| InChIKey | GJFRMUBWVBVYFD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|