C17H25ClFN — CID 81028015
N-[[2-[(2-chloro-4-fluorophenyl)methyl]cyclohexyl]methyl]propan-1-amine (PubChem CID 81028015) has the molecular formula C17H25ClFN and a molecular weight of 297.84 g/mol. Its IUPAC name is N-[[2-[(2-chloro-4-fluorophenyl)methyl]cyclohexyl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(2-chloro-4-fluorophenyl)methyl]cyclohexyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81028015 |
| Molecular Formula | C17H25ClFN |
| Molecular Weight | 297.84 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[[2-[(2-chloro-4-fluorophenyl)methyl]cyclohexyl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCCCC1Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H25ClFN/c1-2-9-20-12-15-6-4-3-5-13(15)10-14-7-8-16(19)11-17(14)18/h7-8,11,13,15,20H,2-6,9-10,12H2,1H3 |
| InChIKey | MCMGYMWJTINCIE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.84 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|