C18H27Cl2N — CID 81033102
N-[[2-[(2,4-dichlorophenyl)methyl]cycloheptyl]methyl]propan-1-amine (PubChem CID 81033102) has the molecular formula C18H27Cl2N and a molecular weight of 328.33 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methyl]cycloheptyl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methyl]cycloheptyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81033102 |
| Molecular Formula | C18H27Cl2N |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methyl]cycloheptyl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCCCCC1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H27Cl2N/c1-2-10-21-13-16-7-5-3-4-6-14(16)11-15-8-9-17(19)12-18(15)20/h8-9,12,14,16,21H,2-7,10-11,13H2,1H3 |
| InChIKey | KROCGRAHZALKMK-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|