C15H21F2N — CID 81010182
[2-[(2,3-difluorophenyl)methyl]cycloheptyl]methanamine (PubChem CID 81010182) has the molecular formula C15H21F2N and a molecular weight of 253.34 g/mol. Its IUPAC name is [2-[(2,3-difluorophenyl)methyl]cycloheptyl]methanamine.
| Compound Name | [2-[(2,3-difluorophenyl)methyl]cycloheptyl]methanamine |
|---|---|
| PubChem CID | 81010182 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | [2-[(2,3-difluorophenyl)methyl]cycloheptyl]methanamine |
| SMILES | NCC1CCCCCC1Cc1cccc(F)c1F |
| InChI | InChI=1S/C15H21F2N/c16-14-8-4-7-12(15(14)17)9-11-5-2-1-3-6-13(11)10-18/h4,7-8,11,13H,1-3,5-6,9-10,18H2 |
| InChIKey | FNZSJWNVKOFNPG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |