C13H22N4O2S — CID 82907550
4-amino-3-[(1-methylpiperidin-3-yl)methylamino]benzenesulfonamide (PubChem CID 82907550) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-amino-3-[(1-methylpiperidin-3-yl)methylamino]benzenesulfonamide.
| Compound Name | 4-amino-3-[(1-methylpiperidin-3-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 82907550 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 4-amino-3-[(1-methylpiperidin-3-yl)methylamino]benzenesulfonamide |
| SMILES | CN1CCCC(CNc2cc(S(N)(=O)=O)ccc2N)C1 |
| InChI | InChI=1S/C13H22N4O2S/c1-17-6-2-3-10(9-17)8-16-13-7-11(20(15,18)19)4-5-12(13)14/h4-5,7,10,16H,2-3,6,8-9,14H2,1H3,(H2,15,18,19) |
| InChIKey | MURLENNGCLOTBO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|