C17H24N4 — CID 102713266
3-methyl-5-N-[(1-methylpiperidin-3-yl)methyl]isoquinoline-5,8-diamine (PubChem CID 102713266) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 3-methyl-5-N-[(1-methylpiperidin-3-yl)methyl]isoquinoline-5,8-diamine.
| Compound Name | 3-methyl-5-N-[(1-methylpiperidin-3-yl)methyl]isoquinoline-5,8-diamine |
|---|---|
| PubChem CID | 102713266 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 3-methyl-5-N-[(1-methylpiperidin-3-yl)methyl]isoquinoline-5,8-diamine |
| SMILES | Cc1cc2c(NCC3CCCN(C)C3)ccc(N)c2cn1 |
| InChI | InChI=1S/C17H24N4/c1-12-8-14-15(10-19-12)16(18)5-6-17(14)20-9-13-4-3-7-21(2)11-13/h5-6,8,10,13,20H,3-4,7,9,11,18H2,1-2H3 |
| InChIKey | YRFNJINAABPHAC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|