About N-(2-chlorophenyl)-1,1-dioxothian-4-amine
N-(2-chlorophenyl)-1,1-dioxothian-4-amine (PubChem CID 43511535) has the molecular formula C11H14ClNO2S
and a molecular weight of 259.76 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1,1-dioxothian-4-amine.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-1,1-dioxothian-4-amine |
| PubChem CID | 43511535 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | N-(2-chlorophenyl)-1,1-dioxothian-4-amine |
| SMILES | O=S1(=O)CCC(Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C11H14ClNO2S/c12-10-3-1-2-4-11(10)13-9-5-7-16(14,15)8-6-9/h1-4,9,13H,5-8H2 |
| InChIKey | NHJVYYMRAHWKOA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chlorophenyl)-1,1-dioxothian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-1,1-dioxothian-4-amine?
The IUPAC name of N-(2-chlorophenyl)-1,1-dioxothian-4-amine (CID 43511535) is N-(2-chlorophenyl)-1,1-dioxothian-4-amine.
What is the SMILES notation for N-(2-chlorophenyl)-1,1-dioxothian-4-amine?
The canonical SMILES for N-(2-chlorophenyl)-1,1-dioxothian-4-amine is O=S1(=O)CCC(Nc2ccccc2Cl)CC1.
What is the InChIKey of N-(2-chlorophenyl)-1,1-dioxothian-4-amine?
The InChIKey is NHJVYYMRAHWKOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO2S/c12-10-3-1-2-4-11(10)13-9-5-7-16(14,15)8-6-9/h1-4,9,13H,5-8H2.
What are the key properties of N-(2-chlorophenyl)-1,1-dioxothian-4-amine?
N-(2-chlorophenyl)-1,1-dioxothian-4-amine has a molecular weight of 259.76 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-1,1-dioxothian-4-amine is sourced from PubChem (CID 43511535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).