C11H14ClNO2S — CID 43511535
N-(2-chlorophenyl)-1,1-dioxothian-4-amine (PubChem CID 43511535) has the molecular formula C11H14ClNO2S and a molecular weight of 259.76 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1,1-dioxothian-4-amine.
| Compound Name | N-(2-chlorophenyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43511535 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | N-(2-chlorophenyl)-1,1-dioxothian-4-amine |
| SMILES | O=S1(=O)CCC(Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C11H14ClNO2S/c12-10-3-1-2-4-11(10)13-9-5-7-16(14,15)8-6-9/h1-4,9,13H,5-8H2 |
| InChIKey | NHJVYYMRAHWKOA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |