C10H12ClNO3S — CID 2435929
(3S,4R)-4-(2-chloroanilino)-1,1-dioxothiolan-3-ol (PubChem CID 2435929) has the molecular formula C10H12ClNO3S and a molecular weight of 261.73 g/mol. Its IUPAC name is (3S,4R)-4-(2-chloroanilino)-1,1-dioxothiolan-3-ol.
| Compound Name | (3S,4R)-4-(2-chloroanilino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 2435929 |
| Molecular Formula | C10H12ClNO3S |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | (3S,4R)-4-(2-chloroanilino)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](O)[C@@H](Nc2ccccc2Cl)C1 |
| InChI | InChI=1S/C10H12ClNO3S/c11-7-3-1-2-4-8(7)12-9-5-16(14,15)6-10(9)13/h1-4,9-10,12-13H,5-6H2/t9-,10+/m0/s1 |
| InChIKey | NAQFNWLMABSPOE-VHSXEESVSA-N |
| XLogP | 0.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |