C11H12Cl2N2O3S — CID 129375199
1-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-(2-chlorophenyl)urea (PubChem CID 129375199) has the molecular formula C11H12Cl2N2O3S and a molecular weight of 323.20 g/mol. Its IUPAC name is 1-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-(2-chlorophenyl)urea.
| Compound Name | 1-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-(2-chlorophenyl)urea |
|---|---|
| PubChem CID | 129375199 |
| Molecular Formula | C11H12Cl2N2O3S |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 1-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-(2-chlorophenyl)urea |
| SMILES | O=C(Nc1ccccc1Cl)N[C@@H]1CS(=O)(=O)C[C@H]1Cl |
| InChI | InChI=1S/C11H12Cl2N2O3S/c12-7-3-1-2-4-9(7)14-11(16)15-10-6-19(17,18)5-8(10)13/h1-4,8,10H,5-6H2,(H2,14,15,16)/t8-,10-/m1/s1 |
| InChIKey | KXEGXSPGGVXHSP-PSASIEDQSA-N |
| XLogP | 1.87 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|