C16H24ClN3O — CID 51168578
1-(2-chlorophenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea (PubChem CID 51168578) has the molecular formula C16H24ClN3O and a molecular weight of 309.84 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea.
| Compound Name | 1-(2-chlorophenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 51168578 |
| Molecular Formula | C16H24ClN3O |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
| SMILES | CC1(C)CC(NC(=O)Nc2ccccc2Cl)CC(C)(C)N1 |
| InChI | InChI=1S/C16H24ClN3O/c1-15(2)9-11(10-16(3,4)20-15)18-14(21)19-13-8-6-5-7-12(13)17/h5-8,11,20H,9-10H2,1-4H3,(H2,18,19,21) |
| InChIKey | FNQJUCQXQFLVRX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |