C17H27N3O2 — CID 108888896
1-(phenoxymethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea (PubChem CID 108888896) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 1-(phenoxymethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea.
| Compound Name | 1-(phenoxymethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 108888896 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 1-(phenoxymethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
| SMILES | CC1(C)CC(NC(=O)NCOc2ccccc2)CC(C)(C)N1 |
| InChI | InChI=1S/C17H27N3O2/c1-16(2)10-13(11-17(3,4)20-16)19-15(21)18-12-22-14-8-6-5-7-9-14/h5-9,13,20H,10-12H2,1-4H3,(H2,18,19,21) |
| InChIKey | VBOZWGYQMNVCBR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|