C23H30N2O2 — CID 35945918
2-(phenoxymethyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 35945918) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-(phenoxymethyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | 2-(phenoxymethyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 35945918 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-(phenoxymethyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | CC1(C)CC(NC(=O)c2ccccc2COc2ccccc2)CC(C)(C)N1 |
| InChI | InChI=1S/C23H30N2O2/c1-22(2)14-18(15-23(3,4)25-22)24-21(26)20-13-9-8-10-17(20)16-27-19-11-6-5-7-12-19/h5-13,18,25H,14-16H2,1-4H3,(H,24,26) |
| InChIKey | IEQNHYSVPNHCKT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |