C23H31N3O2 — CID 67679197
4-[2-(aminomethyl)phenoxy]-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 67679197) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-[2-(aminomethyl)phenoxy]-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | 4-[2-(aminomethyl)phenoxy]-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 67679197 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 4-[2-(aminomethyl)phenoxy]-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | CC1(C)CC(NC(=O)c2ccc(Oc3ccccc3CN)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C23H31N3O2/c1-22(2)13-18(14-23(3,4)26-22)25-21(27)16-9-11-19(12-10-16)28-20-8-6-5-7-17(20)15-24/h5-12,18,26H,13-15,24H2,1-4H3,(H,25,27) |
| InChIKey | WEDDTPMBXKBMKL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |