C23H34N2O2 — CID 123892076
4-(4-methylhexa-2,4-dienoxy)-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 123892076) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 4-(4-methylhexa-2,4-dienoxy)-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | 4-(4-methylhexa-2,4-dienoxy)-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 123892076 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 4-(4-methylhexa-2,4-dienoxy)-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | CC=C(C)C=CCOc1ccc(C(=O)NC2CC(C)(C)NC(C)(C)C2)cc1 |
| InChI | InChI=1S/C23H34N2O2/c1-7-17(2)9-8-14-27-20-12-10-18(11-13-20)21(26)24-19-15-22(3,4)25-23(5,6)16-19/h7-13,19,25H,14-16H2,1-6H3,(H,24,26) |
| InChIKey | CHFFIRSJLUYJHJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|