C22H29N3O — CID 67679426
4-anilino-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 67679426) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is 4-anilino-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | 4-anilino-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 67679426 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 4-anilino-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | CC1(C)CC(NC(=O)c2ccc(Nc3ccccc3)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C22H29N3O/c1-21(2)14-19(15-22(3,4)25-21)24-20(26)16-10-12-18(13-11-16)23-17-8-6-5-7-9-17/h5-13,19,23,25H,14-15H2,1-4H3,(H,24,26) |
| InChIKey | YMRYSDHOANCPNV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |