C11H10Cl3NO3S — CID 7300612
2,4-dichloro-N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 7300612) has the molecular formula C11H10Cl3NO3S and a molecular weight of 342.63 g/mol. Its IUPAC name is 2,4-dichloro-N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 7300612 |
| Molecular Formula | C11H10Cl3NO3S |
| Molecular Weight | 342.63 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | 2,4-dichloro-N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CS(=O)(=O)C[C@@H]1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl3NO3S/c12-6-1-2-7(8(13)3-6)11(16)15-10-5-19(17,18)4-9(10)14/h1-3,9-10H,4-5H2,(H,15,16)/t9-,10-/m0/s1 |
| InChIKey | XSTMAXIHNUBWTL-UWVGGRQHSA-N |
| XLogP | 2.13 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.63 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|