C11H10Cl2N2O5S — CID 78910699
4-chloro-N-(4-chloro-1,1-dioxothiolan-3-yl)-2-nitrobenzamide (PubChem CID 78910699) has the molecular formula C11H10Cl2N2O5S and a molecular weight of 353.18 g/mol. Its IUPAC name is 4-chloro-N-(4-chloro-1,1-dioxothiolan-3-yl)-2-nitrobenzamide.
| Compound Name | 4-chloro-N-(4-chloro-1,1-dioxothiolan-3-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 78910699 |
| Molecular Formula | C11H10Cl2N2O5S |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 4-chloro-N-(4-chloro-1,1-dioxothiolan-3-yl)-2-nitrobenzamide |
| SMILES | O=C(NC1CS(=O)(=O)CC1Cl)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10Cl2N2O5S/c12-6-1-2-7(10(3-6)15(17)18)11(16)14-9-5-21(19,20)4-8(9)13/h1-3,8-9H,4-5H2,(H,14,16) |
| InChIKey | MSIBRKYFVHJIOV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|