C11H10ClF2NO3S — CID 113290281
N-(4-chloro-1,1-dioxothiolan-3-yl)-2,3-difluorobenzamide (PubChem CID 113290281) has the molecular formula C11H10ClF2NO3S and a molecular weight of 309.72 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-2,3-difluorobenzamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 113290281 |
| Molecular Formula | C11H10ClF2NO3S |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2,3-difluorobenzamide |
| SMILES | O=C(NC1CS(=O)(=O)CC1Cl)c1cccc(F)c1F |
| InChI | InChI=1S/C11H10ClF2NO3S/c12-7-4-19(17,18)5-9(7)15-11(16)6-2-1-3-8(13)10(6)14/h1-3,7,9H,4-5H2,(H,15,16) |
| InChIKey | LOTIZIJUMYIINR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|