C10H10ClFN2O3S — CID 113452887
N-(4-chloro-1,1-dioxothiolan-3-yl)-5-fluoropyridine-3-carboxamide (PubChem CID 113452887) has the molecular formula C10H10ClFN2O3S and a molecular weight of 292.72 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-5-fluoropyridine-3-carboxamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 113452887 |
| Molecular Formula | C10H10ClFN2O3S |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-5-fluoropyridine-3-carboxamide |
| SMILES | O=C(NC1CS(=O)(=O)CC1Cl)c1cncc(F)c1 |
| InChI | InChI=1S/C10H10ClFN2O3S/c11-8-4-18(16,17)5-9(8)14-10(15)6-1-7(12)3-13-2-6/h1-3,8-9H,4-5H2,(H,14,15) |
| InChIKey | BMEGFBOYBLTSII-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|