C11H12ClFN2O3S — CID 43853153
1-(4-chloro-1,1-dioxothiolan-3-yl)-3-(4-fluorophenyl)urea (PubChem CID 43853153) has the molecular formula C11H12ClFN2O3S and a molecular weight of 306.75 g/mol. Its IUPAC name is 1-(4-chloro-1,1-dioxothiolan-3-yl)-3-(4-fluorophenyl)urea.
| Compound Name | 1-(4-chloro-1,1-dioxothiolan-3-yl)-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 43853153 |
| Molecular Formula | C11H12ClFN2O3S |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 1-(4-chloro-1,1-dioxothiolan-3-yl)-3-(4-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C11H12ClFN2O3S/c12-9-5-19(17,18)6-10(9)15-11(16)14-8-3-1-7(13)2-4-8/h1-4,9-10H,5-6H2,(H2,14,15,16) |
| InChIKey | BYOJIEXCYQDFOQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|