C18H20N4O4S — CID 7721133
1-[(3R,4R)-1,1-dioxo-4-(phenylcarbamoylamino)thiolan-3-yl]-3-phenylurea (PubChem CID 7721133) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is 1-[(3R,4R)-1,1-dioxo-4-(phenylcarbamoylamino)thiolan-3-yl]-3-phenylurea.
| Compound Name | 1-[(3R,4R)-1,1-dioxo-4-(phenylcarbamoylamino)thiolan-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 7721133 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-[(3R,4R)-1,1-dioxo-4-(phenylcarbamoylamino)thiolan-3-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N[C@H]1CS(=O)(=O)C[C@@H]1NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H20N4O4S/c23-17(19-13-7-3-1-4-8-13)21-15-11-27(25,26)12-16(15)22-18(24)20-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H2,19,21,23)(H2,20,22,24)/t15-,16-/m0/s1 |
| InChIKey | CDJGWHWJYJXGDV-HOTGVXAUSA-N |
| XLogP | 1.80 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |