C10H12ClN3O3S — CID 102566807
1-(4-chloro-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea (PubChem CID 102566807) has the molecular formula C10H12ClN3O3S and a molecular weight of 289.74 g/mol. Its IUPAC name is 1-(4-chloro-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea.
| Compound Name | 1-(4-chloro-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea |
|---|---|
| PubChem CID | 102566807 |
| Molecular Formula | C10H12ClN3O3S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 1-(4-chloro-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea |
| SMILES | O=C(Nc1ccccn1)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C10H12ClN3O3S/c11-7-5-18(16,17)6-8(7)13-10(15)14-9-3-1-2-4-12-9/h1-4,7-8H,5-6H2,(H2,12,13,14,15) |
| InChIKey | QCZOWRYRMSBGDS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|