C13H14ClN5O3S — CID 8684810
N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 8684810) has the molecular formula C13H14ClN5O3S and a molecular weight of 355.81 g/mol. Its IUPAC name is N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 8684810 |
| Molecular Formula | C13H14ClN5O3S |
| Molecular Weight | 355.81 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)N[C@@H]1CS(=O)(=O)C[C@@H]1Cl |
| InChI | InChI=1S/C13H14ClN5O3S/c14-10-7-23(21,22)8-11(10)15-12(20)6-19-17-13(16-18-19)9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,15,20)/t10-,11+/m0/s1 |
| InChIKey | XONIIYMCLVRKKX-WDEREUQCSA-N |
| XLogP | -0.14 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.81 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|