C15H21ClN4O3S — CID 8546679
N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide (PubChem CID 8546679) has the molecular formula C15H21ClN4O3S and a molecular weight of 372.88 g/mol. Its IUPAC name is N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide.
| Compound Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 8546679 |
| Molecular Formula | C15H21ClN4O3S |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide |
| SMILES | O=C(CN1CCN(c2ccccn2)CC1)N[C@H]1CS(=O)(=O)C[C@H]1Cl |
| InChI | InChI=1S/C15H21ClN4O3S/c16-12-10-24(22,23)11-13(12)18-15(21)9-19-5-7-20(8-6-19)14-3-1-2-4-17-14/h1-4,12-13H,5-11H2,(H,18,21)/t12-,13+/m1/s1 |
| InChIKey | AZVDYLRATDNZPS-OLZOCXBDSA-N |
| XLogP | -0.28 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|